| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,1'-(5-Methyl-2,3-Dihydrofuran-2,4-Diyl)Diethanone |
|---|---|
| Synonyms | InChI=1/C9H12O3/c1-5(10)8-4-9(6(2)11)12-7(8)3/h9H,4H2,1-3H3 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 |
| CAS Registry Number | 224424-73-1 |
| SMILES | CC1=C(CC(O1)C(=O)C)C(=O)C |
| InChI | 1S/C9H12O3/c1-5(10)8-4-9(6(2)11)12-7(8)3/h9H,4H2,1-3H3 |
| InChIKey | IYHLXXVFGKFPAD-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.8±40.0°C at 760 mmHg (Cal.) |
| Flash point | 120.7±27.4°C (Cal.) |
| Refractive index | 1.476 (Cal.) |
| (1) | Hisahiro Hagiwara, Kouji Sato, Daisuke Nishino, Takashi Hoshi, Toshio Suzuki and Masayoshi Ando. Domino Michael–O-alkylation reaction: one-pot synthesis of 2,4-diacylhydrofuran derivatives and its application to antitumor naphthofuran synthesis, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 2946. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1'-(5-Methyl-2,3-Dihydrofuran-2,4-Diyl)Diethanone |