|
CAS#: 22450-90-4 Product: Azanide, Phenylmercury, Acetate No suppilers available for the product. |
| Name | Azanide, Phenylmercury, Acetate |
|---|---|
| Synonyms | Amminephenylmercury(1+) acetate; Mercury(1+), amminephenyl-, acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10HgNO2 |
| Molecular Weight | 352.76 |
| CAS Registry Number | 22450-90-4 |
| EINECS | 245-006-6 |
| SMILES | O=C([O-])C.[Hg+]c1ccccc1.[NH2-] |
| InChI | 1S/C6H5.C2H4O2.Hg.H2N/c1-2-4-6-5-3-1;1-2(3)4;;/h1-5H;1H3,(H,3,4);;1H2/q;;+1;-1/p-1 |
| InChIKey | UJTABUXRHHQREO-UHFFFAOYSA-M |
| Refractive index | (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Azanide, Phenylmercury, Acetate |