|
CAS#: 22469-70-1 Product: Ethyl (1R,4R)-4,7,7-Trimethyl-3-Oxobicyclo[2.2.1]Heptane-2-Carboxylate No suppilers available for the product. |
| Name | Ethyl (1R,4R)-4,7,7-Trimethyl-3-Oxobicyclo[2.2.1]Heptane-2-Carboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 |
| CAS Registry Number | 22469-70-1 |
| SMILES | O=C1C([C@H]2CC[C@]1(C)C2(C)C)C(=O)OCC |
| InChI | 1S/C13H20O3/c1-5-16-11(15)9-8-6-7-13(4,10(9)14)12(8,2)3/h8-9H,5-7H2,1-4H3/t8-,9?,13+/m1/s1 |
| InChIKey | ZYSAZWUGDXRNFJ-NNFIZPTKSA-N |
| Density | 1.073g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.793°C at 760 mmHg (Cal.) |
| Flash point | 119.478°C (Cal.) |
| Refractive index | 1.485 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ethyl (1R,4R)-4,7,7-Trimethyl-3-Oxobicyclo[2.2.1]Heptane-2-Carboxylate |