| Beijing Eagle Sky Pharmatech Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.eagleskypharmatech.com | |||
![]() | +86 (10) 5979-9429 8875-5821 | |||
![]() | +86 (10) 5804-3698 | |||
![]() | sophia_818@126.com contact@eagleskypharmatech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | Organic raw materials >> Heterocyclic compound >> Piperidines |
|---|---|
| Name | (6-chloro-2-pyridinyl)(1-methyl-4-piperidinyl)-Methanone |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.71 |
| CAS Registry Number | 225112-16-3 |
| SMILES | CN1CCC(CC1)C(=O)C2=NC(=CC=C2)Cl |
| Solubility | Slightly Soluble (3.8 g/L) (25 °C), Calc.* |
|---|---|
| Density | 1.195±0.06 g/cm3 (20 °C 760 Torr), Calc.* |
| Index of Refraction | 1.554, Calc.* |
| Boiling Point | 353.9±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 167.9±27.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319 Details |
| Safety Statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 Details |
| SDS | Available |
|
(6-chloro-2-pyridinyl)(1-methyl-4-piperidinyl)-Methanone is a chemical compound that has drawn interest in the fields of medicinal chemistry and drug development due to its unique molecular structure and potential biological activity. The compound consists of a methanone group attached to a 6-chloro-2-pyridinyl and 1-methyl-4-piperidinyl group, which suggests that it may have the ability to interact with various biological targets, particularly those involved in neurological and cognitive functions. The discovery of (6-chloro-2-pyridinyl)(1-methyl-4-piperidinyl)-Methanone is part of the ongoing research to find novel bioactive molecules that can modulate specific pathways in the body. Pyridine and piperidine derivatives have long been studied for their diverse pharmacological effects, including their potential as receptor modulators, enzyme inhibitors, and agents for the treatment of a range of diseases. The inclusion of the chloro group and the piperidine ring adds further complexity to the molecule, potentially enhancing its bioactivity and selectivity for certain biological targets. One of the key areas of interest for (6-chloro-2-pyridinyl)(1-methyl-4-piperidinyl)-Methanone is its potential application as a modulator of neurotransmitter receptors. The pyridine ring is a common feature in compounds that interact with nicotinic acetylcholine receptors, which are involved in processes such as learning, memory, and cognition. The piperidine ring may also contribute to the compound's ability to influence the central nervous system by interacting with other receptor systems, including dopaminergic and serotonergic pathways. These interactions suggest that (6-chloro-2-pyridinyl)(1-methyl-4-piperidinyl)-Methanone could be a candidate for the development of treatments for neurological disorders such as Alzheimer's disease, Parkinson's disease, or schizophrenia. In addition to its potential as a receptor modulator, (6-chloro-2-pyridinyl)(1-methyl-4-piperidinyl)-Methanone may have applications in the field of enzyme inhibition. The methanone group in the structure could allow the compound to interact with enzyme active sites, potentially inhibiting the activity of key enzymes involved in disease processes. This property is particularly relevant in the context of diseases such as cancer, where abnormal enzyme activity plays a role in tumor growth and metastasis. Further research into the compound's enzyme-inhibiting properties could provide valuable insights into its therapeutic potential. Furthermore, (6-chloro-2-pyridinyl)(1-methyl-4-piperidinyl)-Methanone's structure lends itself to modification, which is an important feature in drug design. By altering the substituents on the pyridine or piperidine rings, or modifying the methanone group, researchers can potentially improve the compound's pharmacokinetic properties, such as its solubility, stability, and bioavailability. These modifications could help optimize the compound for clinical use, enhancing its therapeutic effectiveness and reducing potential side effects. In conclusion, (6-chloro-2-pyridinyl)(1-methyl-4-piperidinyl)-Methanone is a promising chemical compound with potential applications in the treatment of neurological and other diseases. Its ability to interact with neurotransmitter receptors and enzymes makes it a valuable lead compound for further research in drug development. Ongoing studies are essential to fully explore its biological activity and therapeutic potential. |
| Market Analysis Reports |