Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Methyl-1H-Benzimidazole-5,6-Dicarbonitrile |
|---|---|
| Synonyms | 2-methyl-1H-benzo[d]imidazole-5,6-dicarbonitrile |
| Molecular Structure |  |
| Molecular Formula | C10H6N4 |
| Molecular Weight | 182.18 |
| CAS Registry Number | 226258-72-6 |
| SMILES | Cc1[nH]c2cc(c(cc2n1)C#N)C#N |
| InChI | 1S/C10H6N4/c1-6-13-9-2-7(4-11)8(5-12)3-10(9)14-6/h2-3H,1H3,(H,13,14) |
| InChIKey | GRWOZCKXXPGOOB-UHFFFAOYSA-N |
| Density | 1.373g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.132°C at 760 mmHg (Cal.) |
| Flash point | 166.424°C (Cal.) |
| Refractive index | 1.674 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-1H-Benzimidazole-5,6-Dicarbonitrile |