| Apollo Scientific Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (161) 406-0505 | |||
![]() |
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Sodium 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptanoate |
|---|---|
| Synonyms | MFCD00155772; Sodium 7H-perfluoroheptanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C7HF12NaO2 |
| Molecular Weight | 368.05 |
| CAS Registry Number | 2264-25-7 |
| SMILES | [Na+].FC(F)(C(F)(F)C([O-])=O)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | 1S/C7H2F12O2.Na/c8-1(9)3(10,11)5(14,15)7(18,19)6(16,17)4(12,13)2(20)21;/h1H,(H,20,21);/q;+1/p-1 |
| InChIKey | SZWOFFNEMGRGMA-UHFFFAOYSA-M |
| Melting point | 250°C (Expl.) |
|---|---|
| Boiling point | 188.1°C at 760 mmHg (Cal.) |
| Flash point | 67.6°C (Cal.) |
| Refractive index | (Cal.) |
| Safety Description | S22,S24/25,S36/37/39,S45 |
|---|---|
| R36/37/38 | |
| Irritant | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Sodium 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptanoate |