Online Database of Chemicals from Around the World
| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (203) 786-5290 | |||
 |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Dibenzo[a,l]Pentacene |
|---|---|
| Synonyms | 1,2,8,9-Dibenzpentacene; Dibenzo(A,L)Pentacene |
| Molecular Structure | ![CAS#: 227-09-8， Dibenzo[a,l]Pentacene](/moreStructures/227-09-8.gif) |
| Molecular Formula | C30H18 |
| Molecular Weight | 378.47 |
| CAS Registry Number | 227-09-8 |
| EINECS | 205-933-9 |
| SMILES | C1=C6C(=CC2=C1C=C3C(=C2)C=C4C(=C3)C=CC5=C4C=CC=C5)C=CC7=C6C=CC=C7 |
| InChI | 1S/C30H18/c1-3-7-27-19(5-1)9-11-21-13-23-16-26-18-30-22(12-10-20-6-2-4-8-28(20)30)14-24(26)15-25(23)17-29(21)27/h1-18H |
| InChIKey | XSTMLGGLUNLJRY-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 677.037°C at 760 mmHg (Cal.) |
| Flash point | 360.608°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dibenzo[a,l]Pentacene |