Online Database of Chemicals from Around the World
|
CAS#: 22715-45-3 Product: Ammonium 2,2,3,3,4,4,5,5-Octafluorovalerate No suppilers available for the product. |
| Name | Ammonium 2,2,3,3,4,4,5,5-Octafluorovalerate |
|---|---|
| Synonyms | Ammonium 2,2,3,3,4,4,5,5-Octafluoropentanoate; Ammonium 2,2,3,3,4,4,5,5-Octafluorovalerate |
| Molecular Structure |  |
| Molecular Formula | C5H5F8NO2 |
| Molecular Weight | 263.09 |
| CAS Registry Number | 22715-45-3 |
| EINECS | 245-171-4 |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)F.[NH4+] |
| InChI | 1S/C5H2F8O2.H3N/c6-1(7)3(8,9)5(12,13)4(10,11)2(14)15;/h1H,(H,14,15);1H3 |
| InChIKey | QWLWJLXFHBKUQM-UHFFFAOYSA-N |
| Boiling point | 158.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 49.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium 2,2,3,3,4,4,5,5-Octafluorovalerate |