Online Database of Chemicals from Around the World
|
CAS#: 228253-33-6 Product: 5H-Imidazo[4,5-c][1,5]Naphthyridine No suppilers available for the product. |
| Name | 5H-Imidazo[4,5-c][1,5]Naphthyridine |
|---|---|
| Molecular Structure | ![CAS#: 228253-33-6， 5H-Imidazo[4,5-c][1,5]Naphthyridine](/moreStructures/228253-33-6.gif) |
| Molecular Formula | C9H6N4 |
| Molecular Weight | 170.17 |
| CAS Registry Number | 228253-33-6 |
| SMILES | c1cc2c(c-3ncnc3c[nH]2)nc1 |
| InChI | 1S/C9H6N4/c1-2-6-8(10-3-1)9-7(4-11-6)12-5-13-9/h1-5,11H |
| InChIKey | UFZUBLLGXVDSCW-UHFFFAOYSA-N |
| Density | 1.537g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.584°C at 760 mmHg (Cal.) |
| Flash point | 144.056°C (Cal.) |
| Refractive index | 1.829 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5H-Imidazo[4,5-c][1,5]Naphthyridine |