Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-(Phenylmethyl)-1,3-Benzenediol |
|---|---|
| Synonyms | 4-(Benzyl)Resorcinol; 1,3-Benzenediol, 4-(Phenylmethyl)-; 3-06-00-05404 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 |
| CAS Registry Number | 2284-30-2 |
| EINECS | 218-922-9 |
| SMILES | C1=CC(=CC(=C1CC2=CC=CC=C2)O)O |
| InChI | 1S/C13H12O2/c14-12-7-6-11(13(15)9-12)8-10-4-2-1-3-5-10/h1-7,9,14-15H,8H2 |
| InChIKey | QVFIWTNWKHFVEH-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Melting point | 79°C (Expl.) |
| Boiling point | 367.177°C at 760 mmHg (Cal.) |
| Flash point | 179.78°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(Phenylmethyl)-1,3-Benzenediol |