Online Database of Chemicals from Around the World
|
CAS#: 22890-21-7 Product: 2-Heptylundecanoic Acid No suppilers available for the product. |
| Classification | Analytical chemistry >> Food safety >> Fatty acid, fatty acid methyl ester |
|---|---|
| Name | 2-Heptylundecanoic Acid |
| Synonyms | HEPTADECANE-8-CARBOXYLIC ACID; Isostearic Acid |
| Molecular Structure |  |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 |
| CAS Registry Number | 22890-21-7 |
| SMILES | OC(=O)C(CCCCCCCCC)CCCCCCC |
| InChI | 1S/C18H36O2/c1-3-5-7-9-10-12-14-16-17(18(19)20)15-13-11-8-6-4-2/h17H,3-16H2,1-2H3,(H,19,20) |
| InChIKey | YLZIMEJTDZWVJG-UHFFFAOYSA-N |
| Density | 0.887g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.836°C at 760 mmHg (Cal.) |
| Flash point | 16°C (Expl.) |
| 225.65°C (Cal.) | |
| Refractive index | 1.455 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Heptylundecanoic Acid |