Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-(1-Hexyn-1-Yl)-4-Nitrobenzene |
|---|---|
| Synonyms | 1-(Hex-1-ynyl)-4-nitrobenzene; BENZENE,1-(1-HEXYN-1-YL)-4-NITRO- |
| Molecular Structure |  |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 229022-43-9 |
| SMILES | [O-][N+](=O)c1ccc(C#CCCCC)cc1 |
| InChI | 1S/C12H13NO2/c1-2-3-4-5-6-11-7-9-12(10-8-11)13(14)15/h7-10H,2-4H2,1H3 |
| InChIKey | BILXKRUVEDBOQQ-UHFFFAOYSA-N |
| Density | 1.106g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.305°C at 760 mmHg (Cal.) |
| Flash point | 142.414°C (Cal.) |
| Refractive index | 1.55 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Hexyn-1-Yl)-4-Nitrobenzene |