Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 6,7-Diphenyl-1H-Imidazo[4,5-g]Quinoxaline |
|---|---|
| Synonyms | 1H-IMIDAZO[4,5-G]QUINOXALINE,6,7-DIPHENYL-; 6,7-diphenyl-1H-imidazo[4,5-g]quinoxaline |
| Molecular Structure | ![CAS#: 229182-53-0， 6,7-Diphenyl-1H-Imidazo[4,5-g]Quinoxaline](/moreStructures/229182-53-0.gif) |
| Molecular Formula | C21H14N4 |
| Molecular Weight | 322.36 |
| CAS Registry Number | 229182-53-0 |
| SMILES | c1ccc(cc1)c2c(nc3cc4c(cc3n2)[nH]cn4)c5ccccc5 |
| InChI | 1S/C21H14N4/c1-3-7-14(8-4-1)20-21(15-9-5-2-6-10-15)25-19-12-17-16(22-13-23-17)11-18(19)24-20/h1-13H,(H,22,23) |
| InChIKey | POLMQFZISDRRQV-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 573.258°C at 760 mmHg (Cal.) |
| Flash point | 262.23°C (Cal.) |
| Refractive index | 1.745 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Diphenyl-1H-Imidazo[4,5-g]Quinoxaline |