Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Gelest, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (215) 547-1015 | |||
|
info@gelest.com | |||
| Chemical manufacturer | ||||
| Name | 1,3-Diethyl-1,1,3,3-Tetramethyldisiloxane |
|---|---|
| Synonyms | 1,3-Diethyl tetramethyl disiloxane; 1,3-Diethyl-1,1,3,3-tetramethyldisiloxan; 1,3-diethyl-1,1,3,3-tetramethyldisiloxane |
| Molecular Structure |  |
| Molecular Formula | C8H22OSi2 |
| Molecular Weight | 190.43 |
| CAS Registry Number | 2295-17-2 |
| SMILES | O([Si](C)(C)CC)[Si](CC)(C)C |
| InChI | 1S/C8H22OSi2/c1-7-10(3,4)9-11(5,6)8-2/h7-8H2,1-6H3 |
| InChIKey | XODWWDLLPURTOQ-UHFFFAOYSA-N |
| Density | 0.799g/cm3 (Cal.) |
|---|---|
| Boiling point | 144.572°C at 760 mmHg (Cal.) |
| Flash point | 33.5°C (Cal.) |
| Refractive index | 1.4012 (Expl.) |
| 1.404 (Cal.) | |
| Market Analysis Reports |
| List of Reports Available for 1,3-Diethyl-1,1,3,3-Tetramethyldisiloxane |