|
CAS#: 229621-30-1 Product: S,S'-[(1-Hydroxy-2,2,5,5-tetramethyl-3,4-pyrrolidinediyl)bis(methylene)] dimethanesulfonothioate No suppilers available for the product. |
| Name | S,S'-[(1-Hydroxy-2,2,5,5-tetramethyl-3,4-pyrrolidinediyl)bis(methylene)] dimethanesulfonothioate |
|---|---|
| Synonyms | Diméthane |
| Molecular Structure | ![]() |
| Molecular Formula | C12H25NO5S4 |
| Molecular Weight | 391.59 |
| CAS Registry Number | 229621-30-1 |
| SMILES | CC1(C(C(C(N1O)(C)C)CSS(=O)(=O)C)CSS(=O)(=O)C)C |
| InChI | 1S/C12H25NO5S4/c1-11(2)9(7-19-21(5,15)16)10(8-20-22(6,17)18)12(3,4)13(11)14/h9-10,14H,7-8H2,1-6H3 |
| InChIKey | UFKKQFGMIKQTFD-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 606.0±28.0°C at 760 mmHg (Cal.) |
| Flash point | 320.3±24.0°C (Cal.) |
| Refractive index | 1.546 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for S,S'-[(1-Hydroxy-2,2,5,5-tetramethyl-3,4-pyrrolidinediyl)bis(methylene)] dimethanesulfonothioate |