Online Database of Chemicals from Around the World
|
CAS#: 22965-81-7 Product: alpha-Methylserotonin No suppilers available for the product. |
| Name | alpha-Methylserotonin |
|---|---|
| Synonyms | 3-(2-Amino-1-Methyl-Ethyl)-1H-Indol-5-Ol; 3-(2-Amino-1-Methylethyl)-1H-Indol-5-Ol; Pdsp2_001664 |
| Molecular Structure |  |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.24 |
| CAS Registry Number | 22965-81-7 |
| SMILES | C2=C(C(C)CN)C1=CC(=CC=C1[NH]2)O |
| InChI | 1S/C11H14N2O/c1-7(5-12)10-6-13-11-3-2-8(14)4-9(10)11/h2-4,6-7,13-14H,5,12H2,1H3 |
| InChIKey | RPGDCRNUJYFGLT-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.943°C at 760 mmHg (Cal.) |
| Flash point | 198.098°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Methylserotonin |