Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Ethyl 2-(2-Furoyl)-3-Oxobutanoate |
|---|---|
| Synonyms | 2-(Furan-2-carbonyl)-3-oxo-butyric acid ethyl; 2-(Furan-2-carbonyl)-3-oxo-butyric acid ethylester; ester |
| Molecular Structure |  |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 |
| CAS Registry Number | 22997-07-5 |
| SMILES | O=C(c1occc1)C(C(=O)OCC)C(=O)C |
| InChI | 1S/C11H12O5/c1-3-15-11(14)9(7(2)12)10(13)8-5-4-6-16-8/h4-6,9H,3H2,1-2H3 |
| InChIKey | FMWDBBDGFITFLO-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.37°C at 760 mmHg (Cal.) |
| Flash point | 143.321°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-(2-Furoyl)-3-Oxobutanoate |