Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 2330-8079751 | |||
|
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | Ethyl 3-(4-Isobutylphenyl)Propanoate |
|---|---|
| Synonyms | 3-(4-Isobutyl-phenyl)-propionic acid ethyl ester; BENZENEPROPANOIC ACID,4-(2-METHYLPROPYL)-, ETHYL ESTER; ethyl 3-[4-(2-methylpropyl)phenyl]propanoate |
| Molecular Structure |  |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.33 |
| CAS Registry Number | 230287-81-7 |
| SMILES | CCOC(=O)CCc1ccc(cc1)CC(C)C |
| InChI | 1S/C15H22O2/c1-4-17-15(16)10-9-13-5-7-14(8-6-13)11-12(2)3/h5-8,12H,4,9-11H2,1-3H3 |
| InChIKey | HQCIUZLBNNCORC-UHFFFAOYSA-N |
| Density | 0.97g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.324°C at 760 mmHg (Cal.) |
| Flash point | 108.355°C (Cal.) |
| Refractive index | 1.494 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-(4-Isobutylphenyl)Propanoate |