Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6352-9955 | |||
|
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4'-(Dibromomethyl)-4-Biphenylcarbonitrile |
|---|---|
| Synonyms | 4'-(Dibromomethyl)-[1,1'-Biphenyl]-4-Carbonitrile |
| Molecular Structure |  |
| Molecular Formula | C14H9Br2N |
| Molecular Weight | 351.04 |
| CAS Registry Number | 230647-73-1 |
| SMILES | c1cc(ccc1C#N)c2ccc(cc2)C(Br)Br |
| InChI | 1S/C14H9Br2N/c15-14(16)13-7-5-12(6-8-13)11-3-1-10(9-17)2-4-11/h1-8,14H |
| InChIKey | GHJNTBAQUREHJE-UHFFFAOYSA-N |
| Density | 1.724g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.887°C at 760 mmHg (Cal.) |
| Flash point | 213.788°C (Cal.) |
| Refractive index | 1.67 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-(Dibromomethyl)-4-Biphenylcarbonitrile |