| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3,7-Dihydro-2H-Purin-2-One |
|---|---|
| Synonyms | 2H-Purin-2-One, 1,3-Dihydro; Aids-026217; Aids026217 |
| Molecular Structure | ![]() |
| Molecular Formula | C5H4N4O |
| Molecular Weight | 136.11 |
| CAS Registry Number | 2308-57-8 |
| SMILES | C2=NC1=C(C=NC(=O)N1)[NH]2 |
| InChI | 1S/C5H4N4O/c10-5-6-1-3-4(9-5)8-2-7-3/h1-2H,(H2,6,7,8,9,10) |
| InChIKey | CRIZPXKICGBNKG-UHFFFAOYSA-N |
| Density | 1.892g/cm3 (Cal.) |
|---|---|
| Boiling point | 683.3°C at 760 mmHg (Cal.) |
| Flash point | 367.1°C (Cal.) |
| (1) | Elżbieta Bojarska, Zygmunt Kazimierczuk, Claire Mouchard, Francis Tfibel and Marie-Pierre Fontaine-Aupart. UVC induced oxidation of chloropurines: excited singlet and triplet pathways for the photoreaction, Photochem. Photobiol. Sci., 2008, 7, 1054. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,7-Dihydro-2H-Purin-2-One |