Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,5-Dimethoxy-4H-Pyrazole 1,2-Dioxide |
|---|---|
| Synonyms | 3,5-dimethoxy-4H-pyrazole 1,2-dioxide |
| Molecular Structure |  |
| Molecular Formula | C5H8N2O4 |
| Molecular Weight | 160.13 |
| CAS Registry Number | 230952-03-1 |
| SMILES | COC1=[N+]([N+](=C(C1)OC)[O-])[O-] |
| InChI | 1S/C5H8N2O4/c1-10-4-3-5(11-2)7(9)6(4)8/h3H2,1-2H3 |
| InChIKey | AIQSGPZNQKDWOJ-UHFFFAOYSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.76°C at 760 mmHg (Cal.) |
| Flash point | 138.115°C (Cal.) |
| Refractive index | 1.524 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dimethoxy-4H-Pyrazole 1,2-Dioxide |