|
CAS#: 231292-16-3 Product: [6-Chloro-2-(4-Chlorobenzoyl)-1H-Indol-3-Yl]Acetic Acid No suppilers available for the product. |
| Name | [6-Chloro-2-(4-Chlorobenzoyl)-1H-Indol-3-Yl]Acetic Acid |
|---|---|
| Synonyms | [6-Chloro-2-(4-chloro-benzoyl)-1H-indol-3-yl]-acetic acid; 6-Chloro-2-(4-chlorobenzoyl)indol-3-acetic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H11Cl2NO3 |
| Molecular Weight | 348.18 |
| CAS Registry Number | 231292-16-3 |
| SMILES | Clc1ccc(cc1)C(=O)c3c(c2ccc(Cl)cc2n3)CC(=O)O |
| InChI | 1S/C17H11Cl2NO3/c18-10-3-1-9(2-4-10)17(23)16-13(8-15(21)22)12-6-5-11(19)7-14(12)20-16/h1-7,20H,8H2,(H,21,22) |
| InChIKey | YDQDBRSFDWZTGQ-UHFFFAOYSA-N |
| Density | 1.505g/cm3 (Cal.) |
|---|---|
| Boiling point | 633.588°C at 760 mmHg (Cal.) |
| Flash point | 336.982°C (Cal.) |
| Refractive index | 1.698 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [6-Chloro-2-(4-Chlorobenzoyl)-1H-Indol-3-Yl]Acetic Acid |