Online Database of Chemicals from Around the World
|
CAS#: 231632-03-4 Product: 5-Thia-7,13-Diazatetracyclo[9.3.1.02,10.04,8]Pentadeca-1,3,7,9,11,13-Hexaene No suppilers available for the product. |
| Name | 5-Thia-7,13-Diazatetracyclo[9.3.1.02,10.04,8]Pentadeca-1,3,7,9,11,13-Hexaene |
|---|---|
| Synonyms | 5,9-METHANO-2H-THIAZOLO[4,5-H][3]BENZAZEPINE(9CI) |
| Molecular Structure | ![CAS#: 231632-03-4， 5-Thia-7,13-Diazatetracyclo[9.3.1.0<Sup>2,10</Sup>.0<Sup>4,8</Sup>]Pentadeca-1,3,7,9,11,13-Hexaene](/moreStructures/231632-03-4.gif) |
| Molecular Formula | C12H8N2S |
| Molecular Weight | 212.27 |
| CAS Registry Number | 231632-03-4 |
| SMILES | c1c2=C3CC(=CN=C3)c2cc4=NCSc41 |
| InChI | 1S/C12H8N2S/c1-7-4-13-5-8(1)10-3-12-11(2-9(7)10)14-6-15-12/h2-5H,1,6H2 |
| InChIKey | ABNXNNBXHNTJCD-UHFFFAOYSA-N |
| Density | 1.565g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.721°C at 760 mmHg (Cal.) |
| Flash point | 225.784°C (Cal.) |
| Refractive index | 1.869 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Thia-7,13-Diazatetracyclo[9.3.1.02,10.04,8]Pentadeca-1,3,7,9,11,13-Hexaene |