Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2,4-Trimethylphenanthrene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 23189-64-2 |
| SMILES | C1=CC=CC2=C1C3=C(C=C2)C(=C(C)C=C3C)C |
| InChI | 1S/C17H16/c1-11-10-12(2)17-15(13(11)3)9-8-14-6-4-5-7-16(14)17/h4-10H,1-3H3 |
| InChIKey | QADBXFVBJIVDGK-UHFFFAOYSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.635°C at 760 mmHg (Cal.) |
| Flash point | 180.253°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4-Trimethylphenanthrene |