Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (3R)-3-Fluoro-3-(Trifluoromethyl)-2,2-Oxiranediol |
|---|---|
| Synonyms | (R)-3-fluoro-3-(trifluoromethyl)oxirane-2,2-diol |
| Molecular Structure |  |
| Molecular Formula | C3H2F4O3 |
| Molecular Weight | 162.04 |
| CAS Registry Number | 232260-61-6 |
| SMILES | [C@@]1(C(O1)(O)O)(C(F)(F)F)F |
| InChI | 1S/C3H2F4O3/c4-1(2(5,6)7)3(8,9)10-1/h8-9H/t1-/m1/s1 |
| InChIKey | JYVDHQKMEZJYJV-PVQJCKRUSA-N |
| Density | 1.937g/cm3 (Cal.) |
|---|---|
| Boiling point | 184.6°C at 760 mmHg (Cal.) |
| Flash point | 93.722°C (Cal.) |
| Refractive index | 1.376 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R)-3-Fluoro-3-(Trifluoromethyl)-2,2-Oxiranediol |