Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Carbamimidamido-5-methyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| Synonyms | 2-guanidino-5-methylthiazole-4-carboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C6H8N4O2S |
| Molecular Weight | 200.22 |
| CAS Registry Number | 232596-13-3 |
| SMILES | N=C(N)Nc1nc(C(O)=O)c(C)s1 |
| InChI | 1S/C6H8N4O2S/c1-2-3(4(11)12)9-6(13-2)10-5(7)8/h1H3,(H,11,12)(H4,7,8,9,10) |
| InChIKey | VTRLVNDDKWUMCS-UHFFFAOYSA-N |
| Density | 1.79g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.306°C at 760 mmHg (Cal.) |
| Flash point | 210.413°C (Cal.) |
| Refractive index | 1.779 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Carbamimidamido-5-methyl-1,3-thiazole-4-carboxylic acid |