|
CAS#: 23291-96-5 Product: Dehydromonocrotaline No suppilers available for the product. |
| Name | Dehydromonocrotaline |
|---|---|
| Synonyms | 2H-(,6)Dioxacyclounlecino(2,3,4-Gh)Pyrrolizine-2,6(3H)-Dione, 4,5,8,12,13,13A-Hexahydro-4,5-Dihydroxy-3,4,5-Trimethyl-, (3R,4R,5R,13Ar)-; 2H-(,6)Dioxacyclounlecino(2,3,4-Gh)Pyrrolizine-2,6(3H)-Dione, 4,5,8,12,13,13A-Hexahydro-4,5-Dihydroxy-3,4,5-Trimethyl-, (3R-(3R*,4R*,5R*,13Ar*))-; 3,8-Didehydromonocrotaline |
| Molecular Structure | ![]() |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 |
| CAS Registry Number | 23291-96-5 |
| SMILES | [C@H]12OC(=O)[C@@H]([C@@](O)([C@@](O)(C(OCC3=C1[N](CC2)C=C3)=O)C)C)C |
| InChI | 1S/C16H21NO6/c1-9-13(18)23-11-5-7-17-6-4-10(12(11)17)8-22-14(19)16(3,21)15(9,2)20/h4,6,9,11,20-21H,5,7-8H2,1-3H3/t9-,11+,15+,16-/m0/s1 |
| InChIKey | ZONSVLURFASOJK-LLAGZRPASA-N |
| Density | 1.433g/cm3 (Cal.) |
|---|---|
| Boiling point | 556.974°C at 760 mmHg (Cal.) |
| Flash point | 290.647°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dehydromonocrotaline |