Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 5-Fluoro-2-Methyl-Benzenesulfonamide |
|---|---|
| Synonyms | 5-Fluoro-2-Methyl-Benzenesulfonamide; Nsc372535 |
| Molecular Structure |  |
| Molecular Formula | C7H8FNO2S |
| Molecular Weight | 189.20 |
| CAS Registry Number | 2339-57-3 |
| SMILES | C1=C(F)C=CC(=C1[S](N)(=O)=O)C |
| InChI | 1S/C7H8FNO2S/c1-5-2-3-6(8)4-7(5)12(9,10)11/h2-4H,1H3,(H2,9,10,11) |
| InChIKey | FOUNRCAARPHIQC-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.148°C at 760 mmHg (Cal.) |
| Flash point | 155.888°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Fluoro-2-Methyl-Benzenesulfonamide |