| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Name | Methyl (2E)-3,7-Dimethyl-2,6-Octadienoate |
|---|---|
| Synonyms | (E)-Geranic acid, methyl ester; E-Methylgeranate; geranic acid methyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 |
| CAS Registry Number | 2349-14-6 |
| SMILES | CC(=CCC/C(=C/C(=O)OC)/C)C |
| InChI | 1S/C11H18O2/c1-9(2)6-5-7-10(3)8-11(12)13-4/h6,8H,5,7H2,1-4H3/b10-8+ |
| InChIKey | ACOBBFVLNKYODD-CSKARUKUSA-N |
| Density | 0.925 (Expl.) |
|---|---|
| 0.9±0.1g/cm3 (Cal.) | |
| Boiling point | 70°C (Expl.) |
| 247.4±19.0°C at 760 mmHg (Cal.) | |
| Flash point | 109.6±12.6°C (Cal.) |
| 99°C (Expl.) | |
| Refractive index | 1.457 (Cal.) |
| 1.469 (Expl.) | |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl (2E)-3,7-Dimethyl-2,6-Octadienoate |