|
CAS#: 2351-13-5 Product: Bromomethyl-(Bromomethyl-Dimethylsilyl)Oxy-Dimethylsilane No suppilers available for the product. |
| Name | Bromomethyl-(Bromomethyl-Dimethylsilyl)Oxy-Dimethylsilane |
|---|---|
| Synonyms | Bromomethyl-(Bromomethyl-Dimethyl-Silyl)Oxy-Dimethyl-Silane; 1,3-Bis(Bromomethyl)-1,1,3,3-Tetramethyldisiloxane; 1,3-Bis(Bromomethyl)Tetramethyldisiloxane |
| Molecular Structure | ![]() |
| Molecular Formula | C6H16Br2OSi2 |
| Molecular Weight | 320.17 |
| CAS Registry Number | 2351-13-5 |
| EINECS | 219-083-1 |
| SMILES | C([Si](O[Si](CBr)(C)C)(C)C)Br |
| InChI | 1S/C6H16Br2OSi2/c1-10(2,5-7)9-11(3,4)6-8/h5-6H2,1-4H3 |
| InChIKey | UPKHMNVQWIFQBW-UHFFFAOYSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 185.962°C at 760 mmHg (Cal.) |
| Flash point | 66.268°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Bromomethyl-(Bromomethyl-Dimethylsilyl)Oxy-Dimethylsilane |