Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Iodo-2,4,5-Trichloro-Acetanilide |
|---|---|
| Synonyms | 2-Chloro-N-(4,5-Dichloro-2-Iodo-Phenyl)Acetamide; 2-Chloro-N-(4,5-Dichloro-2-Iodo-Phenyl)Ethanamide; 2'-Iodo-2,4',5'-Trichloroacetanilide |
| Molecular Structure |  |
| Molecular Formula | C8H5Cl3INO |
| Molecular Weight | 364.40 |
| CAS Registry Number | 23543-02-4 |
| SMILES | C1=C(C(=CC(=C1NC(CCl)=O)I)Cl)Cl |
| InChI | 1S/C8H5Cl3INO/c9-3-8(14)13-7-2-5(11)4(10)1-6(7)12/h1-2H,3H2,(H,13,14) |
| InChIKey | OUYDNYHHLCOIHX-UHFFFAOYSA-N |
| Density | 2.026g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.965°C at 760 mmHg (Cal.) |
| Flash point | 217.464°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Iodo-2,4,5-Trichloro-Acetanilide |