Online Database of Chemicals from Around the World
|
CAS#: 23564-66-1 Product: N-(2-Naphtyl)Isonicotinamidine No suppilers available for the product. |
| Name | N-(2-Naphtyl)Isonicotinamidine |
|---|---|
| Synonyms | N'-(2-Naphthyl)Pyridine-4-Carboxamidine; N'-(2-Naphthyl)-4-Pyridinecarboxamidine; N'-(2-Naphthyl)Isonicotinamidine |
| Molecular Structure |  |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 |
| CAS Registry Number | 23564-66-1 |
| SMILES | C1=CC(=CC2=C1C=CC=C2)N=C(C3=CC=NC=C3)N |
| InChI | 1S/C16H13N3/c17-16(13-7-9-18-10-8-13)19-15-6-5-12-3-1-2-4-14(12)11-15/h1-11H,(H2,17,19) |
| InChIKey | ZNOAHNFNDCYOFD-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.044°C at 760 mmHg (Cal.) |
| Flash point | 236.26°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Naphtyl)Isonicotinamidine |