Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | N-Benzyl-N-Phenylglycine |
|---|---|
| Synonyms | Glycine, N-phenyl-N-(phenylmethyl)-; Glycine,N-phenyl-N-(phenylmethyl)- |
| Molecular Structure |  |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 |
| CAS Registry Number | 23582-63-0 |
| SMILES | OC(=O)CN(Cc1ccccc1)c2ccccc2 |
| InChI | 1S/C15H15NO2/c17-15(18)12-16(14-9-5-2-6-10-14)11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H,17,18) |
| InChIKey | KUPDILJKKXVBLS-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.831°C at 760 mmHg (Cal.) |
| Flash point | 214.964°C (Cal.) |
| Refractive index | 1.634 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Benzyl-N-Phenylglycine |