Online Database of Chemicals from Around the World
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
 |
+44 (1457) 860-111 | |||
 |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Name | 4-Bromophenyl Propionate |
|---|---|
| Synonyms | Propanoic Acid (4-Bromophenyl) Ester; Propionic Acid (4-Bromophenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 |
| CAS Registry Number | 23600-77-3 |
| EINECS | 245-772-1 |
| SMILES | C1=C(OC(=O)CC)C=CC(=C1)Br |
| InChI | 1S/C9H9BrO2/c1-2-9(11)12-8-5-3-7(10)4-6-8/h3-6H,2H2,1H3 |
| InChIKey | JPUYGYIPZTYGTI-UHFFFAOYSA-N |
| Density | 1.434g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.606°C at 760 mmHg (Cal.) |
| Flash point | 115.644°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Bromophenyl Propionate |