| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 5,6-Dibromo-1,1,1,2,2,3,3,4,4-Nonafluorohexane |
|---|---|
| Synonyms | 1,2-Dibromo-1H,1H,2H-perfluorohexane; 1,2-Dibromo-2-(perfluoro-n-butyl)rthane; 1,2-Dibromo-3,3,4,4,5,5,6,6,6-nonafluorohexane 97% |
| Molecular Structure | ![]() |
| Molecular Formula | C6H3Br2F9 |
| Molecular Weight | 405.88 |
| CAS Registry Number | 236736-19-9 |
| SMILES | FC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(Br)CBr |
| InChI | 1S/C6H3Br2F9/c7-1-2(8)3(9,10)4(11,12)5(13,14)6(15,16)17/h2H,1H2 |
| InChIKey | ABBOXTQECRSSQR-UHFFFAOYSA-N |
| Density | 1.994g/cm3 (Cal.) |
|---|---|
| 2.048 (Expl.) | |
| Boiling point | 56°C (Expl.) |
| 168.704°C at 760 mmHg (Cal.) | |
| Flash point | 55.83°C (Cal.) |
| Refractive index | 1.378 (Expl.) |
| 1.375 (Cal.) | |
| Safety Description | Irritant |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dibromo-1,1,1,2,2,3,3,4,4-Nonafluorohexane |