|
CAS#: 23684-48-2 Product: L-alpha-Glutamyl-L-alpha-Glutamyl-L-Glutamic Acid No suppilers available for the product. |
| Name | L-alpha-Glutamyl-L-alpha-Glutamyl-L-Glutamic Acid |
|---|---|
| Synonyms | EEE; E-E-E; glu-glu-glu |
| Molecular Structure | ![]() |
| Molecular Formula | C15H23N3O10 |
| Molecular Weight | 405.36 |
| CAS Registry Number | 23684-48-2 |
| SMILES | O=C(N[C@H](C(=O)O)CCC(=O)O)[C@@H](NC(=O)[C@@H](N)CCC(=O)O)CCC(=O)O |
| InChI | 1S/C15H23N3O10/c16-7(1-4-10(19)20)13(25)17-8(2-5-11(21)22)14(26)18-9(15(27)28)3-6-12(23)24/h7-9H,1-6,16H2,(H,17,25)(H,18,26)(H,19,20)(H,21,22)(H,23,24)(H,27,28)/t7-,8-,9-/m0/s1 |
| InChIKey | BUZMZDDKFCSKOT-CIUDSAMLSA-N |
| Density | 1.494g/cm3 (Cal.) |
|---|---|
| Boiling point | 915.314°C at 760 mmHg (Cal.) |
| Flash point | 507.364°C (Cal.) |
| Refractive index | 1.566 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-alpha-Glutamyl-L-alpha-Glutamyl-L-Glutamic Acid |