|
CAS#: 23726-94-5 Product: (Z)-1-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-2-Buten-1-One No suppilers available for the product. |
| Name | (Z)-1-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-2-Buten-1-One |
|---|---|
| Synonyms | (Z)-1-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-2-Buten-1-One; 2-Buten-1-One, 1-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-,; 2-Buten-1-One, 1-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-, (2Z)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 23726-94-5 |
| EINECS | 245-845-8 |
| SMILES | CC1(C(C(=CCC1)C)C(=O)\C=C/C)C |
| InChI | 1S/C13H20O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,7-8,12H,6,9H2,1-4H3/b7-5- |
| InChIKey | CRIGTVCBMUKRSL-ALCCZGGFSA-N |
| Density | 0.898g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.126°C at 760 mmHg (Cal.) |
| Flash point | 105.731°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-1-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-2-Buten-1-One |