Online Database of Chemicals from Around the World
|
CAS#: 23757-24-6 Product: 4,6-Bis(Isopropyl)-3,3-Dimethylindan-5-Ol No suppilers available for the product. |
| Name | 4,6-Bis(Isopropyl)-3,3-Dimethylindan-5-Ol |
|---|---|
| Synonyms | 4,6-Diisopropyl-3,3-Dimethyl-Indan-5-Ol; 4,6-Diisopropyl-3,3-Dimethyl-5-Indanol; 4,6-Bis(Isopropyl)-3,3-Dimethylindan-5-Ol |
| Molecular Structure |  |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 |
| CAS Registry Number | 23757-24-6 |
| EINECS | 245-867-8 |
| SMILES | C1=C(C(=C(C2=C1CCC2(C)C)C(C)C)O)C(C)C |
| InChI | 1S/C17H26O/c1-10(2)13-9-12-7-8-17(5,6)15(12)14(11(3)4)16(13)18/h9-11,18H,7-8H2,1-6H3 |
| InChIKey | UYWDZENSLVNYKE-UHFFFAOYSA-N |
| Density | 0.964g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.633°C at 760 mmHg (Cal.) |
| Flash point | 145.299°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Bis(Isopropyl)-3,3-Dimethylindan-5-Ol |