Online Database of Chemicals from Around the World
| Name | Methoxy(Dimethyl)(Pentafluorophenyl)Silane |
|---|---|
| Synonyms | Benzene, 1,2,3,4,5-pentafluoro-6-(methoxydimethylsilyl)- |
| Molecular Structure |  |
| Molecular Formula | C9H9F5OSi |
| Molecular Weight | 256.24 |
| CAS Registry Number | 23761-74-2 |
| SMILES | Fc1c(F)c(F)c(F)c(F)c1[Si](OC)(C)C |
| InChI | 1S/C9H9F5OSi/c1-15-16(2,3)9-7(13)5(11)4(10)6(12)8(9)14/h1-3H3 |
| InChIKey | CEEVCOGSFYACND-UHFFFAOYSA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 214.08°C at 760 mmHg (Cal.) |
| Flash point | 83.273°C (Cal.) |
| Refractive index | 1.418 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methoxy(Dimethyl)(Pentafluorophenyl)Silane |
