Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 6-Methoxy-1H-Indol-5-Ol |
|---|---|
| Synonyms | 1H-Indol-5-Ol, 6-Methoxy-; 5-Hydroxy-6-Methoxyindole; 5H6mi |
| Molecular Structure |  |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 |
| CAS Registry Number | 2380-83-8 |
| SMILES | C1=C(OC)C(=CC2=C1[NH]C=C2)O |
| InChI | 1S/C9H9NO2/c1-12-9-5-7-6(2-3-10-7)4-8(9)11/h2-5,10-11H,1H3 |
| InChIKey | WZARGPVIAOAKMH-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.877°C at 760 mmHg (Cal.) |
| Flash point | 171.448°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-1H-Indol-5-Ol |