Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-Propan-2-Yl-4-Prop-1-En-2-Ylbenzene |
|---|---|
| Synonyms | 1-Isopropenyl-4-Isopropyl-Benzene; 1-Isopropenyl-4-Isopropylbenzene; 1-Propan-2-Yl-4-Prop-1-En-2-Yl-Benzene |
| Molecular Structure |  |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 |
| CAS Registry Number | 2388-14-9 |
| EINECS | 219-218-4 |
| SMILES | C1=C(C(C)C)C=CC(=C1)C(C)=C |
| InChI | 1S/C12H16/c1-9(2)11-5-7-12(8-6-11)10(3)4/h5-8,10H,1H2,2-4H3 |
| InChIKey | XMCNZCCURGYSDQ-UHFFFAOYSA-N |
| Density | 0.865g/cm3 (Cal.) |
|---|---|
| Boiling point | 220.344°C at 760 mmHg (Cal.) |
| Flash point | 80.46°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Propan-2-Yl-4-Prop-1-En-2-Ylbenzene |