Online Database of Chemicals from Around the World
|
CAS#: 2389-75-5 Product: 4,11-Dichloroquinacridonequinone No suppilers available for the product. |
| Name | 4,11-Dichloroquinacridonequinone |
|---|---|
| Synonyms | 4,11-Dichloroquino(2,3-B)Acridine-6,7,13,14(5H,12H)-Tetrone; Quino(2,3-B)Acridine-6,7,13,14(5H,12H)-Tetrone, 4,11-Dichloro- |
| Molecular Structure |  |
| Molecular Formula | C20H8Cl2N2O4 |
| Molecular Weight | 411.20 |
| CAS Registry Number | 2389-75-5 |
| EINECS | 219-224-7 |
| SMILES | C1=CC=C5C(=C1Cl)NC2=C(C(C4=C(C2=O)C(=O)C3=C(C(=CC=C3)Cl)N4)=O)C5=O |
| InChI | 1S/C20H8Cl2N2O4/c21-9-5-1-3-7-13(9)23-15-11(17(7)25)19(27)16-12(20(15)28)18(26)8-4-2-6-10(22)14(8)24-16/h1-6H,(H,23,25)(H,24,26) |
| InChIKey | QNOGVEMFYBHBED-UHFFFAOYSA-N |
| Density | 1.754g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.22°C at 760 mmHg (Cal.) |
| Flash point | 317.407°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,11-Dichloroquinacridonequinone |