Online Database of Chemicals from Around the World
|
CAS#: 239-60-1 Product: 13H-Dibenzo(a,i)Fluorene No suppilers available for the product. |
| Name | 13H-Dibenzo(a,i)Fluorene |
|---|---|
| Synonyms | 1,2,7,8-Dibenzfluorene; 13H-Dibenzo(A,I)Fluorene; 4-05-00-02692 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C21H14 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 239-60-1 |
| SMILES | C2=C1C4=C(CC1=CC3=C2C=CC=C3)C=CC5=C4C=CC=C5 |
| InChI | 1S/C21H14/c1-2-7-16-13-20-18(11-15(16)6-1)12-17-10-9-14-5-3-4-8-19(14)21(17)20/h1-11,13H,12H2 |
| InChIKey | IHBKFZHOCLQNME-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.653°C at 760 mmHg (Cal.) |
| Flash point | 242.874°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 13H-Dibenzo(a,i)Fluorene |