Online Database of Chemicals from Around the World
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+86 (21) 6141-5566 / 800-819-3336 | |||
 |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | (2H4)Butanedinitrile |
|---|---|
| Synonyms | <2,2,3,3-(2)H4>succinonitrile; Succinonitrile-d4; 293067_ALDRICH |
| Molecular Structure |  |
| Molecular Formula | C4D4N2 |
| Molecular Weight | 84.11 |
| CAS Registry Number | 23923-29-7 |
| SMILES | [2H]C([2H])(C#N)C([2H])([2H])C#N |
| InChI | 1S/C4H4N2/c5-3-1-2-4-6/h1-2H2/i1D2,2D2 |
| InChIKey | IAHFWCOBPZCAEA-LNLMKGTHSA-N |
| Density | 1.034g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.485°C at 760 mmHg (Cal.) |
| Flash point | 141.117°C (Cal.) |
| Refractive index | 1.415 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2H4)Butanedinitrile |