Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-(2,4,6-Tribromophenoxy)-Ethanol |
|---|---|
| Synonyms | Ethanol, 2-(2,4,6-Tribromophenoxy)- |
| Molecular Structure |  |
| Molecular Formula | C8H7Br3O2 |
| Molecular Weight | 374.85 |
| CAS Registry Number | 23976-66-1 |
| EINECS | 245-961-9 |
| SMILES | C1=C(Br)C=C(C(=C1Br)OCCO)Br |
| InChI | 1S/C8H7Br3O2/c9-5-3-6(10)8(7(11)4-5)13-2-1-12/h3-4,12H,1-2H2 |
| InChIKey | GXNDUUQGAZRKDB-UHFFFAOYSA-N |
| Density | 2.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.69°C at 760 mmHg (Cal.) |
| Flash point | 186.454°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4,6-Tribromophenoxy)-Ethanol |