Online Database of Chemicals from Around the World
|
CAS#: 23984-17-0 Product: Pierisformosin B No suppilers available for the product. |
| Name | Pierisformosin B |
|---|---|
| Synonyms | Asebotoxin I; Grayanotoxane-3,5,6,10,14,16-Hexol, 14-Propionate, (3-Beta,6-Beta,14R)- |
| Molecular Structure |  |
| Molecular Formula | C23H38O7 |
| Molecular Weight | 426.55 |
| CAS Registry Number | 23984-17-0 |
| SMILES | [C@]234[C@H]([C@@](O)([C@H]1[C@@](O)(C([C@@H](O)C1)(C)C)[C@H](O)C2)C)CC[C@H](C3OC(=O)CC)[C@](O)(C4)C |
| InChI | 1S/C23H38O7/c1-6-17(26)30-18-12-7-8-13-21(5,28)14-9-15(24)19(2,3)23(14,29)16(25)10-22(13,18)11-20(12,4)27/h12-16,18,24-25,27-29H,6-11H2,1-5H3/t12-,13+,14+,15+,16-,18?,20-,21-,22+,23+/m1/s1 |
| InChIKey | UVIOAKNWFGGRCJ-SZLBESSXSA-N |
| Density | 1.307g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.478°C at 760 mmHg (Cal.) |
| Flash point | 185.479°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pierisformosin B |