Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-(1-Oxido-4-Pyridinyl)-Ethanone |
|---|---|
| Synonyms | 1-(1-Oxido-4-Pyridin-1-Iumyl)Ethanone; Nsc356032 |
| Molecular Structure |  |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 |
| CAS Registry Number | 2402-96-2 |
| SMILES | C1=C[N+](=CC=C1C(C)=O)[O-] |
| InChI | 1S/C7H7NO2/c1-6(9)7-2-4-8(10)5-3-7/h2-5H,1H3 |
| InChIKey | GUHDDRZAZNIQJB-UHFFFAOYSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.276°C at 760 mmHg (Cal.) |
| Flash point | 163.827°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(1-Oxido-4-Pyridinyl)-Ethanone |