|
CAS#: 24055-46-7 Product: 2,3-Dimethyl-1-Nitronaphthalene No suppilers available for the product. |
| Name | 2,3-Dimethyl-1-Nitronaphthalene |
|---|---|
| Synonyms | 2,3-Dimethyl-1-Nitro-Naphthalene; Nsc95714; Nciopen2_005872 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 |
| CAS Registry Number | 24055-46-7 |
| SMILES | C1=CC=CC2=C1C(=C(C(=C2)C)C)[N+]([O-])=O |
| InChI | 1S/C12H11NO2/c1-8-7-10-5-3-4-6-11(10)12(9(8)2)13(14)15/h3-7H,1-2H3 |
| InChIKey | HAJFJHPDGUZFGH-UHFFFAOYSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.269°C at 760 mmHg (Cal.) |
| Flash point | 163.901°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethyl-1-Nitronaphthalene |