Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 4-Cinnamylphenol |
|---|---|
| Synonyms | 4-(3-Phenylprop-2-Enyl)Phenol; Nsc154312; Obtusastyrene |
| Molecular Structure |  |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 |
| CAS Registry Number | 24126-82-7 |
| SMILES | C1=C(C=CC(=C1)O)C\C=C\C2=CC=CC=C2 |
| InChI | 1S/C15H14O/c16-15-11-9-14(10-12-15)8-4-7-13-5-2-1-3-6-13/h1-7,9-12,16H,8H2/b7-4+ |
| InChIKey | YNPGXIGIEYOFEX-QPJJXVBHSA-N |
| Density | 1.109g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.492°C at 760 mmHg (Cal.) |
| Flash point | 174.652°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Cinnamylphenol |