|
CAS#: 24160-51-8 Product: 1,2,4-Trimethoxy-5-(2-Nitrovinyl)Benzene No suppilers available for the product. |
| Name | 1,2,4-Trimethoxy-5-(2-Nitrovinyl)Benzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.22 |
| CAS Registry Number | 24160-51-8 |
| SMILES | [O-][N+](=O)C=Cc1c(OC)cc(OC)c(OC)c1 |
| InChI | 1S/C11H13NO5/c1-15-9-7-11(17-3)10(16-2)6-8(9)4-5-12(13)14/h4-7H,1-3H3 |
| InChIKey | DPZJDIXHUBSWDS-UHFFFAOYSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.644°C at 760 mmHg (Cal.) |
| Flash point | 177.663°C (Cal.) |
| Refractive index | 1.553 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4-Trimethoxy-5-(2-Nitrovinyl)Benzene |